A0621812
3-Azetidinecarboxylic acid , 98% , 36476-78-5
CAS NO.：36476-78-5
Empirical Formula: C4H7NO2
Molecular Weight: 101.1
MDL number: MFCD00191763
EINECS: 674-976-7
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB20.00 | In Stock |
|
| 250MG | RMB28.00 | In Stock |
|
| 1G | RMB53.60 | In Stock |
|
| 5G | RMB216.80 | In Stock |
|
| 25G | RMB756.00 | In Stock |
|
| 100G | RMB2421.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 286 °C (dec.) (lit.) |
| Boiling point: | 189.47°C (rough estimate) |
| Density | 1.2245 (rough estimate) |
| refractive index | 1.4540 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Water (Slightly) |
| pka | 2.74±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Soluble in water. |
| InChI | InChI=1S/C4H7NO2/c6-4(7)3-1-5-2-3/h3,5H,1-2H2,(H,6,7) |
| InChIKey | GFZWHAAOIVMHOI-UHFFFAOYSA-N |
| SMILES | N1CC(C(O)=O)C1 |
| CAS DataBase Reference | 36476-78-5(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Azetidinecarboxylic acid (36476-78-5) |
Description and Uses
Azetidine and its derivatives are valuable compounds in pharmaceutical and agrochemical research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-22-36-26 |
| WGK Germany | 3 |
| RTECS | CM4310600 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Toxicity | LD50 orl-rat: >5 g/kg FMCHA2 -,C65,91 |
