A4359912
1-Fmoc-azetidine-3-carboxylic acid , ≥98.0%(HPLC) , 193693-64-0
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB45.60 | In Stock |
|
| 250mg | RMB158.40 | In Stock |
|
| 500MG | RMB174.40 | In Stock |
|
| 1g | RMB298.40 | In Stock |
|
| 5g | RMB2092.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174 °C |
| Boiling point: | 540-545℃ |
| Density | 1.368 |
| Flash point: | 282°(540°F) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 4.16±0.20(Predicted) |
| color | White to Almost white |
| Major Application | peptide synthesis |
| InChI | 1S/C19H17NO4/c21-18(22)12-9-20(10-12)19(23)24-11-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,12,17H,9-11H2,(H,21,22) |
| InChIKey | QDEJCUHGSHSYQH-UHFFFAOYSA-N |
| SMILES | OC(=O)C1CN(C1)C(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 193693-64-0(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37-60 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
