BD0850645
Fmoc-Phe(3-CF3)-OH , 95% , 205526-27-8
Synonym(s):
Fmoc-3-(trifluoromethyl)-L -phenylalanine
CAS NO.:205526-27-8
Empirical Formula: C25H20F3NO4
Molecular Weight: 455.43
MDL number: MFCD00672555
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB100.80 | In Stock |
|
| 1g | RMB221.60 | In Stock |
|
| 5g | RMB979.20 | In Stock |
|
| 25g | RMB3533.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-157°C |
| Boiling point: | 611.2±55.0 °C(Predicted) |
| Density | 1.351±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 3.68±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Major Application | peptide synthesis |
| InChIKey | AJMRBDCOLBEYRZ-QFIPXVFZSA-N |
| SMILES | OC(=O)[C@H](Cc1cccc(c1)C(F)(F)F)NC(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 205526-27-8(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |





