BD8665931
Fmoc-Phe(3-F)-OH , 97% , 198560-68-8
Synonym(s):
Fmoc-3-fluoro-L -phenylalanine;Fmoc-Phe(3-F)-OH
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.80 | In Stock |
|
| 1g | RMB77.60 | In Stock |
|
| 5g | RMB269.60 | In Stock |
|
| 10g | RMB487.20 | In Stock |
|
| 25g | RMB1100.00 | In Stock |
|
| 100g | RMB2854.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155.8 °C |
| Boiling point: | 618.1±55.0 °C(Predicted) |
| alpha | -39 º (c=1,DMF) |
| Density | 1.2642 (estimate) |
| storage temp. | 2-8°C |
| form | solid |
| pka | 3.70±0.10(Predicted) |
| color | beige |
| Major Application | peptide synthesis |
| InChI | 1S/C24H20FNO4/c25-16-7-5-6-15(12-16)13-22(23(27)28)26-24(29)30-14-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-12,21-22H,13-14H2,(H,26,29)(H,27,28)/t22-/m0/s1 |
| InChIKey | DWSDVARCJDOADL-QFIPXVFZSA-N |
| SMILES | FC1=CC=CC(C[C@H](NC(OCC2C3=C(C4=C2C=CC=C4)C=CC=C3)=O)C(O)=O)=C1 |
| CAS DataBase Reference | 198560-68-8(CAS DataBase Reference) |
Description and Uses
Phenylalanine derivative was introduced in collaboration with Yu and coworkers in reflection to a methodology reported in C-H Activation.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |
