A0650712
6-Aminouracil , 98% , 873-83-6
Synonym(s):
4-Amino-2,6-dihydroxypyrimidine;6-Amino-2,4-pyrimidinediol
CAS NO.:873-83-6
Empirical Formula: C4H5N3O2
Molecular Weight: 127.1
MDL number: MFCD00006071
EINECS: 212-854-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB24.00 | In Stock |
|
| 100G | RMB52.00 | In Stock |
|
| 250G | RMB102.40 | In Stock |
|
| 500G | RMB212.80 | In Stock |
|
| 2.5kg | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥360 °C(lit.) |
| Boiling point: | 235.85°C (rough estimate) |
| Density | 1.4748 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 3.76±0.10(Predicted) |
| color | Cream to light brown |
| Water Solubility | slightly soluble |
| BRN | 120491 |
| InChI | InChI=1S/C4H5N3O2/c5-2-1-3(8)7-4(9)6-2/h1H,(H4,5,6,7,8,9) |
| InChIKey | LNDZXOWGUAIUBG-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(N)=CC(=O)N1 |
| CAS DataBase Reference | 873-83-6(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4(1H,3H)-Pyrimidinedione, 6-amino- (873-83-6) |
Description and Uses
6-Aminouracil is used as an intermediate in pharmaceuticals such as caffeine, theophylline, and SDM.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280f |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | YQ8750000 |
| F | 10-23 |
| TSCA | TSCA listed |
| HS Code | 29335995 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LDLo par-mus: 2400 mg/kg CBCCT* 7,696,55 |
| REACH Registrations | Active |







