A0653912
Fmoc-Asp(OAll)-OH , 98% , 146982-24-3
Synonym(s):
Fmoc-L -aspartic acid 4-allyl ester;Fmoc-Asp(OAll)-OH
| Pack Size | Price | Stock | Quantity |
| 1G | RMB59.20 | In Stock |
|
| 5G | RMB223.20 | In Stock |
|
| 25G | RMB1006.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 111-115 °C |
| Boiling point: | 638.5±55.0 °C(Predicted) |
| Density | 1.286±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in water or 1% acetic acid |
| form | Solid |
| pka | 3.59±0.23(Predicted) |
| color | White to off-white |
| optical activity | [α]20/D 27±2°, c = 1% in DMF |
| Water Solubility | Slightly soluble in water. |
| BRN | 6670219 |
| Major Application | peptide synthesis |
| InChI | 1S/C22H21NO6/c1-2-11-28-20(24)12-19(21(25)26)23-22(27)29-13-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h2-10,18-19H,1,11-13H2,(H,23,27)(H,25,26)/t19-/m0/s1 |
| InChIKey | FBNFRRNBFASDKS-IBGZPJMESA-N |
| SMILES | OC(=O)[C@H](CC(=O)OCC=C)NC(=O)OCC1c2ccccc2-c3ccccc13 |
| CAS DataBase Reference | 146982-24-3(CAS DataBase Reference) |
Description and Uses
Fmoc-Asp(OAll)-OH, is an amino acid building block used in peptide synthesis. With a growing peptide drug market the fast, reliable synthesis of peptides is of great importance.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H200-H302-H335-H312 |
| Precautionary statements | P201-P202-P281-P372-P373-P380-P401-P501-P280-P302+P352-P312-P322-P363-P501-P264-P270-P301+P312-P330-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| Storage Class | 11 - Combustible Solids |







