A0665112
L-Alanine tert-Butyl Ester Hydrochloride , 97% , 13404-22-3
CAS NO.:13404-22-3
Empirical Formula: C7H16ClNO2
Molecular Weight: 181.66
MDL number: MFCD00035524
EINECS: 236-497-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB44.00 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100G | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-175 °C (dec.) |
| refractive index | 2.0 ° (C=2, EtOH) |
| storage temp. | 2-8°C |
| solubility | Soluble in methanol. |
| form | Solid or Crystalline Powder |
| color | White to off-white |
| optical activity | [α]20/D +1.4±0.2°, c = 2% in ethanol |
| Sensitive | Hygroscopic |
| BRN | 3562140 |
| InChI | InChI=1/C7H15NO2.ClH/c1-5(8)6(9)10-7(2,3)4;/h5H,8H2,1-4H3;1H/t5-;/s3 |
| InChIKey | WIQIWPPQGWGVHD-USHJBNIQNA-N |
| SMILES | C(C)(C)(C)OC(=O)[C@@H](N)C.Cl |&1:7,r| |
| CAS DataBase Reference | 13404-22-3(CAS DataBase Reference) |
Description and Uses
L-Alanine tert-butyl ester is a protected form of L-Alanine (A481500). L-Alanine used to make in-vivo measurement of glucose and alanine metabolism in studies of patients with diabetes. L-Alanine is a non-essential amino acid for human development and is one of the 20 amino acids encoded by the genetic code.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29224995 |







