A7714512
L-Tyrosine tert-butyl ester , 98% , 16874-12-7
CAS NO.:16874-12-7
Empirical Formula: C13H19NO3
Molecular Weight: 237.29
MDL number: MFCD00042644
EINECS: 240-902-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB84.00 | In Stock |
|
| 25G | RMB317.60 | In Stock |
|
| 100g | RMB1109.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141-144 °C |
| Boiling point: | 358.1±27.0 °C(Predicted) |
| Density | 1.125±0.06 g/cm3(Predicted) |
| refractive index | 25 ° (C=2, EtOH) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| pka | 9.80±0.15(Predicted) |
| form | Powder |
| color | White |
| optical activity | [α]20/D +25±1°, c = 2% in ethanol |
| BRN | 2696011 |
| InChI | InChI=1S/C13H19NO3/c1-13(2,3)17-12(16)11(14)8-9-4-6-10(15)7-5-9/h4-7,11,15H,8,14H2,1-3H3/t11-/m0/s1 |
| InChIKey | DIGHFXIWRPMGSA-NSHDSACASA-N |
| SMILES | C(OC(C)(C)C)(=O)[C@H](CC1=CC=C(O)C=C1)N |
| CAS DataBase Reference | 16874-12-7(CAS DataBase Reference) |
Description and Uses
L-Tyrosine tert-butyl ester is a protected form of L-Tyrosine (T899975). L-Tyrosine is an essential amino acid that exhibits in vitro antioxidant and antiradical activities. L-Tyrosine is used as a precursor to synthesize catecholamines (e.g. Norepinephrine HCl [N674500]) in human keratinocytes, and also for the synthesis of proteins and thyroid hormones.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H361-H372-H410 |
| Precautionary statements | P201-P264-P280-P301+P330+P331-P312 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29225090 |









