BD0869853
(S)-tert-Butyl2-amino-3-methylbutanoate , 95% , 13211-31-9
CAS NO.：13211-31-9
Empirical Formula: C9H19NO2
Molecular Weight: 173.25
MDL number: MFCD00237308
EINECS: 236-180-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB98.40 | In Stock |
|
| 5g | RMB347.20 | In Stock |
|
| 25g | RMB1216.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 77-78 °C(Press: 12 Torr) |
| Density | 0.936±0.06 g/cm3(Predicted) |
| storage temp. | -15°C |
| form | liquid |
| pka | 7.91±0.33(Predicted) |
| color | Colourless |
| InChI | InChI=1S/C9H19NO2/c1-6(2)7(10)8(11)12-9(3,4)5/h6-7H,10H2,1-5H3/t7-/m0/s1 |
| InChIKey | RJBVJBGFJIHJSZ-ZETCQYMHSA-N |
| SMILES | C(OC(C)(C)C)(=O)[C@H](C(C)C)N |
| CAS DataBase Reference | 13211-31-9(CAS DataBase Reference) |
Description and Uses
tert-Butyl L-valinate is a crucial compound that could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2922498590 |
