A0666312
(7-Azabenzotriazol-1-yloxy)tripyrrolidinophosphonium hexafluorophosphate , 97% , 156311-83-0
Synonym(s):
(3-Hydroxy-3H-1,2,3-triazolo[4,5-b]pyridinato-O)tri-1-pyrrolidinyl-phosphorus hexafluorophosphate;(7-Azabenzotriazol-1-yloxy)trispyrrolidinophosphonium hexafluorophosphate;PyAOP
CAS NO.：156311-83-0
Empirical Formula: C17H27F6N7OP2
Molecular Weight: 521.38
MDL number: MFCD03703417
EINECS: 627-192-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB37.60 | In Stock |
|
| 5G | RMB136.00 | In Stock |
|
| 25G | RMB728.00 | In Stock |
|
| 100g | RMB2595.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163-168 °C(lit.) |
| RTECS | TH3890000 |
| storage temp. | -20°C |
| solubility | Soluble in water or 1% acetic acid |
| form | Powder or Crystalline Powder |
| color | White to off-white |
| Water Solubility | Soluble in water. |
| InChI | InChI=1S/C17H27N7OP.F6P/c1-2-11-21(10-1)26(22-12-3-4-13-22,23-14-5-6-15-23)25-24-17-16(19-20-24)8-7-9-18-17;1-7(2,3,4,5)6/h7-9H,1-6,10-15H2;/q+1;-1 |
| InChIKey | CBZAHNDHLWAZQC-UHFFFAOYSA-N |
| SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].[P+](N1CCCC1)(N1CCCC1)(N1CCCC1)ON1N=NC2C=CC=NC1=2 |
| CAS DataBase Reference | 156311-83-0(CAS DataBase Reference) |
| EPA Substance Registry System | Phosphorus(1+), [3-(hydroxy-.kappa.O)-3H-1,2,3-triazolo[4,5-b]pyridinato]tri-1-pyrrolidinyl-, (T-4)-, hexafluorophosphate(1-) (1:1) (156311-83-0) |
Description and Uses
PyAOP is a phosphonium salt used as a coupling reagent in solid-phase peptide synthesis, without undergoing side reactions with the amino terminus. PyAOP is a derivative of HOAt (H805070).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29339900 |
