A0687512
β-D-Glucosamine pentaacetate , 98% , 7772-79-4
Synonym(s):
β-D -Glucosamine pentaacetate;2-Amino-2-deoxy-β-D -glucopyranosyl pentaacetate
CAS NO.:7772-79-4
Empirical Formula: C16H23NO10
Molecular Weight: 389.35
MDL number: MFCD00006595
EINECS: 231-865-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB88.00 | In Stock |
|
| 5G | RMB356.00 | In Stock |
|
| 25g | RMB1357.60 | In Stock |
|
| 100g | RMB4506.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186-189 °C(lit.) |
| Boiling point: | 530.2±50.0 °C(Predicted) |
| Density | 1.30±0.1 g/cm3(Predicted) |
| refractive index | 2 ° (C=5, CHCl3) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly, Heated, Sonicated), Methanol (Slightly, Heated, Sonicated) |
| pka | 13.41±0.70(Predicted) |
| form | Solid |
| color | White to Light Brown |
| optical activity | [α]24/D +1.7 to +3.0°, c = 10 in chloroform |
| BRN | 98835 |
| InChI | 1S/C16H23NO10/c1-7(18)17-13-15(25-10(4)21)14(24-9(3)20)12(6-23-8(2)19)27-16(13)26-11(5)22/h12-16H,6H2,1-5H3,(H,17,18)/t12-,13-,14-,15-,16-/m1/s1 |
| InChIKey | OVPIZHVSWNOZMN-OXGONZEZSA-N |
| SMILES | CC(=O)N[C@H]1[C@@H](O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O)OC(C)=O |
| CAS DataBase Reference | 7772-79-4(CAS DataBase Reference) |
Description and Uses
An N-acetylglucosamine derivatives as promoters for hyaluronic acid production.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |






