A0710612
Amidosulfuron , Analysis standard , 120923-37-7
Synonym(s):
1-(4,6-Dimethoxypyrimidin-2-yl)-3-(N-mesyl-N-methylsulfamoyl)urea
CAS NO.:120923-37-7
Empirical Formula: C9H15N5O7S2
Molecular Weight: 369.37
MDL number: MFCD01310639
EINECS: 407-380-0
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160-163°C |
| Density | 1.594±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 0.12±0.40(Predicted) |
| color | White to Off-White |
| Henry's Law Constant | 6.4×105 mol/(m3Pa) at 25℃, Maniere et al. (2011) |
| Stability: | Hygroscopic, Unstable in Solution |
| Major Application | agriculture environmental |
| InChI | 1S/C9H15N5O7S2/c1-14(22(4,16)17)23(18,19)13-9(15)12-8-10-6(20-2)5-7(11-8)21-3/h5H,1-4H3,(H2,10,11,12,13,15) |
| InChIKey | CTTHWASMBLQOFR-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)N(C)S(C)(=O)=O)n1 |
| LogP | 1.630 |
| CAS DataBase Reference | 120923-37-7(CAS DataBase Reference) |
Description and Uses
Amidosulfuron, is used as pesticide and herbicides.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273 |
| PPE | Eyeshields, Faceshields, Gloves |
| Risk Statements | 52/53 |
| Safety Statements | 61 |
| WGK Germany | 1 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| REACH Registrations | Inactive |







