A7329612
Sulfometuron-methyl , Analysis standard , 74222-97-2
CAS NO.:74222-97-2
Empirical Formula: C15H16N4O5S
Molecular Weight: 364.38
MDL number: MFCD00128060
EINECS: 277-780-6
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB398.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203-205°C |
| Boiling point: | 197°C (rough estimate) |
| Density | 1.48 |
| refractive index | 1.6000 (estimate) |
| pka | 5.7(at 25℃) |
| Major Application | agriculture environmental |
| InChI | 1S/C15H16N4O5S/c1-9-8-10(2)17-14(16-9)18-15(21)19-25(22,23)12-7-5-4-6-11(12)13(20)24-3/h4-8H,1-3H3,(H2,16,17,18,19,21) |
| InChIKey | ZDXMLEQEMNLCQG-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc2nc(C)cc(C)n2 |
| CAS DataBase Reference | 74222-97-2(CAS DataBase Reference) |
| EPA Substance Registry System | Sulfometuron methyl (74222-97-2) |
Description and Uses
Metsulfuron-methyl is a sulfonylurea herbicide that inhibits the synthesis of branched-chain amino acids, thereby inhibiting cell division at the growing tips of plants, preventing the growth of weeds, and leading to chlorosis and necrosis. It is suitable for the control of annual and perennial grass weeds and broadleaf weeds in forestry.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H400 |
| Precautionary statements | P273-P391-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50 |
| Safety Statements | 61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | DG9096550 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 |
| Hazardous Substances Data | 74222-97-2(Hazardous Substances Data) |
| Toxicity | LD50 in male, female rats (mg/kg): >5000, >5000 orally (Harding) |




