A0712050
Pentamidineisethionate , ≥98% , 140-64-7
Synonym(s):
1,5-Bis(p-amidinophenoxy)pentane bis(2-hydroxyethanesulfonate salt);4,4′-(Pentamethylenedioxy)dibenzamidine bis(2-hydroxyethanesulfonate);Pentamidine isethionate salt
CAS NO.:140-64-7
Empirical Formula: C23H36N4O10S2
Molecular Weight: 592.68
MDL number: MFCD00079213
EINECS: 205-424-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB89.60 | In Stock |
|
| 1g | RMB223.20 | In Stock |
|
| 50mg | RMB432.00 | In Stock |
|
| 5g | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-194 °C(lit.) |
| storage temp. | 2-8°C |
| solubility | Freely soluble in water, sparingly soluble in ethanol (96 per cent), practically insoluble in methylene chloride. |
| form | powder |
| color | White to Off-White |
| Merck | 13,7192 |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | YBVNFKZSMZGRAD-UHFFFAOYSA-N |
| SMILES | C1(OCCCCCOC2=CC=C(C(=N)N)C=C2)C=CC(C(N)=N)=CC=1.C(CO)S(=O)(=O)O.C(CO)S(=O)(=O)O |
| CAS DataBase Reference | 140-64-7(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanesulfonic acid, 2-hydroxy-, compd. with 4,4'-[1,5-pentanediylbis(oxy)]bis[benzenecarboximidamide] (2:1) (140-64-7) |
Description and Uses
Antiparasitic
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36/37 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | CV6500000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2925294500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Toxicity | LD50 intraperitoneal in mouse: 63mg/kg |






