A7644758
Metoclopramide , 10mMinDMSO , 364-62-5
Synonym(s):
4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide;Methoxychloroprocainamide
CAS NO.:364-62-5
Empirical Formula: C14H22ClN3O2
Molecular Weight: 299.8
MDL number: MFCD00211338
EINECS: 206-662-9
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-148°C |
| Boiling point: | 418.7±45.0 °C(Predicted) |
| Density | 1.2432 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | 2-8°C |
| solubility | Practically insoluble in water, sparingly soluble or slightly soluble in ethanol (96 per cent), slightly soluble in methylene chloride |
| form | Solid |
| pka | pKa 0.42± 0.03;9.71± 0.02(H2O)(Approximate) |
| color | White to Off-White |
| BRN | 1884366 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C14H22ClN3O2/c1-4-18(5-2)7-6-17-14(19)10-8-11(15)12(16)9-13(10)20-3/h8-9H,4-7,16H2,1-3H3,(H,17,19) |
| InChIKey | TTWJBBZEZQICBI-UHFFFAOYSA-N |
| SMILES | C(NCCN(CC)CC)(=O)C1=CC(Cl)=C(N)C=C1OC |
| CAS DataBase Reference | 364-62-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzamide, 4-amino-5-chloro-n-[2-(diethylamino)ethyl]-2-methoxy-(364-62-5) |
Description and Uses
Metoclopramide is a treatment of choice of post-operative nausea and vomiting (PONV) prophylaxis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22-64 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HS Code | 2924.29.7790 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 364-62-5(Hazardous Substances Data) |





