A0717912
Arsenazo Ⅲ , AR , 1668-00-4
Synonym(s):
2,2′-(1,8-Dihydroxy-3,6-disulfonaphthylene-2,7-bisazo)bisbenzenearsonic acid;2,7-Bis(2-arsonophenylazo)-1,8-dihydroxynaphthaline-3,6-disulfonic acid;2,7-Bis(2-arsonophenylazo)chromotropic acid;Arsenazo III
CAS NO.:1668-00-4
Empirical Formula: C22H18As2N4O14S2
Molecular Weight: 776.37
MDL number: MFCD00078931
EINECS: 216-788-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB147.20 | In Stock |
|
| 5G | RMB606.40 | In Stock |
|
| 10G | RMB1140.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >320 °C(lit.) |
| bulk density | 850kg/m3 |
| storage temp. | Store below +30°C. |
| solubility | ammonium hydroxide: soluble1mg/mL |
| form | Powder |
| pka | -1.25±0.40(Predicted) |
| color | Brown |
| PH | 2.3 (10g/l, H2O, 20℃) |
| λmax | 569-576 nm (buffer pH 10.0) |
| BRN | 5717957 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChIKey | UQHVTNUJRKELCE-UHFFFAOYSA-N |
| SMILES | C1=C2C(C(O)=C(N=NC3=CC=CC=C3[As](O)(O)=O)C(S(O)(=O)=O)=C2)=C(O)C(N=NC2=CC=CC=C2[As](O)(O)=O)=C1S(O)(=O)=O |
Description and Uses
Arsenazo III is usually used in the determination of calcium in serum,has been used to evaluate calcium transport in permeabilized cells,has also been used for the spectrophotometric determination of uranium and thorium.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H331-H410 |
| Precautionary statements | P261-P264-P270-P273-P301+P310-P304+P340+P311 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,N |
| Risk Statements | 23/25-50/53 |
| Safety Statements | 20/21-28-45-60-61 |
| RIDADR | UN 3465 6.1/PG 2 |
| WGK Germany | 3 |
| HS Code | 2931 90 00 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |






