A0736656
Oxybenzone
Synonym(s):
2-Hydroxy-4-methoxybenzophenone;Oxybenzone
CAS NO.:
Empirical Formula: C14H12O3
Molecular Weight: 228.24
MDL number: MFCD00008387
EINECS: 205-031-5
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB1353.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-64 °C(lit.) |
| Boiling point: | 150-160 °C5 mm Hg(lit.) |
| Density | 1,3 g/cm3 |
| vapor pressure | 0.001Pa at 25℃ |
| refractive index | 1.5805 (estimate) |
| Flash point: | 216°C |
| storage temp. | 2-8°C |
| solubility | 95% ethanol: soluble50mg/mL, clear, colorless |
| form | Crystalline Powder |
| pka | 7.56±0.35(Predicted) |
| color | White to light yellow |
| Odor | ylsh. cryst., rose-like odor |
| Water Solubility | <0.1 g/100 mL at 20 ºC |
| Merck | 14,6954 |
| BRN | 1913145 |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| Cosmetics Ingredients Functions | LIGHT STABILIZER UV ABSORBER UV FILTER |
| Cosmetic Ingredient Review (CIR) | UV absorber UV-9 (131-57-7) |
| InChI | 1S/C14H12O3/c1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10/h2-9,15H,1H3 |
| InChIKey | DXGLGDHPHMLXJC-UHFFFAOYSA-N |
| SMILES | COc1ccc(c(O)c1)C(=O)c2ccccc2 |
| LogP | 3.45 at 40℃ |
| CAS DataBase Reference | 131-57-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Oxybenzone(131-57-7) |
| EPA Substance Registry System | 2-Hydroxy-4-methoxybenzophenone (131-57-7) |
Description and Uses
Ultraviolet light absorber and stabilizer, especially in plastics and paints.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37 |
| RIDADR | UN 3077 9/PG III |
| WGK Germany | 2 |
| RTECS | DJ1575000 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29145000 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 2 |
| Hazardous Substances Data | 131-57-7(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: >12.8 g/kg (Lewerenz) |







