A0737712
(S)-(+)-2-Aminobutanamide hydrochloride , 99% , 7682-20-4
Synonym(s):
(S)-(+)-2-Aminobutanamide hydrochloride;(S)-2-Aminobutyramide hydrochloride
CAS NO.:7682-20-4
Empirical Formula: C4H11ClN2O
Molecular Weight: 138.6
MDL number: MFCD00136565
EINECS: 200-001-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB66.40 | In Stock |
|
| 25G | RMB155.20 | In Stock |
|
| 100G | RMB388.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 259-263 °C |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]22/D +24°, c = 1 in H2O |
| Stability: | Stable. Incompatible with oxidizing agents. |
| InChI | InChI=1/C4H10N2O.ClH/c1-2-3(5)4(6)7;/h3H,2,5H2,1H3,(H2,6,7);1H/t3-;/s3 |
| InChIKey | HDBMIDJFXOYCGK-DFWYDOINSA-N |
| SMILES | [C@H](N)(CC)C(=O)N.Cl |&1:0,r| |
| CAS DataBase Reference | 7682-20-4(CAS DataBase Reference) |
Description and Uses
(S)-2-Aminobutyramide hydrochloride can be used to synthesize many other compounds, including amino acids, pharmaceuticals, and polymers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37-36/37/38 |
| WGK Germany | 3 |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







