LN1128757
98% , 358629-47-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB2604.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 443.0±28.0 °C(Predicted) |
| Density | 1.222±0.06 g/cm3(Predicted) |
| storage temp. | Amber Vial, Refrigerator, Under inert atmosphere |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| pka | 16.35±0.50(Predicted) |
| color | Off-White to Pale Beige |
| Stability: | Light Sensitive |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C8H12N2O2/c1-2-6(8(9)12)10-5-3-4-7(10)11/h2H,3-5H2,1H3,(H2,9,12)/b6-2- |
| InChIKey | ZGHRUXLFLIMTAG-KXFIGUGUSA-N |
| SMILES | C(N)(=O)/C(/N1CCCC1=O)=C/C |
Description and Uses
Dehydro Levetiracetam (Levetiracetam EP Impurity B) is an impurity of Levetiracetam (L331500) which is an (S)-enantiomer of Etiracetam (E932970) and the ethyl analog of Piracetam (P500800). Used as an anticonvulsant.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P |
| Storage Class | 11 - Combustible Solids |







