LN7572751
LevetiracetamimpurityD , 98% , 103765-01-1
Synonym(s):
(R)-Etiracetam;(2R)-2-(2-Oxopyrrolidin-1-yl)butanamide
| Pack Size | Price | Stock | Quantity |
| 2.5MG | RMB1596.00 | In Stock |
|
| 10MG | RMB5267.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114-116 °C(Solv: acetone (67-64-1)) |
| Boiling point: | 395.9±25.0 °C(Predicted) |
| Density | 1.168±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Acetone (Sparingly, Sonicated), Chloroform (Slightly), Methanol (Slightly) |
| pka | 15.74±0.50(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C8H14N2O2/c1-2-6(8(9)12)10-5-3-4-7(10)11/h6H,2-5H2,1H3,(H2,9,12)/t6-/m1/s1 |
| InChIKey | HPHUVLMMVZITSG-ZCFIWIBFSA-N |
| SMILES | N1(CCCC1=O)[C@H](CC)C(=O)N |
Description and Uses
(R)-Levetiracetam [REV] (Levetiracetam EP Impurity D), is the enantiomer to Levetiracetam [LEV] (L331500), the antiepileptic drug that is highly enantioselective. It is apparent that [LEV] is more potent than [REV] in terms of antiepileptic potency.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H319-H411 |
| Precautionary statements | P264-P270-P273-P280-P301+P312-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 |
