A0739112
5-Aminoquinoline , >97.0%(T) , 611-34-7
Synonym(s):
5-Quinolinamine
CAS NO.：611-34-7
Empirical Formula: C9H8N2
Molecular Weight: 144.17
MDL number: MFCD00006797
EINECS: 210-266-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB74.40 | In Stock |
|
| 25G | RMB351.20 | In Stock |
|
| 100G | RMB1276.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 106-109 °C (lit.) |
| Boiling point: | 310 °C (lit.) |
| Density | 1.1148 (estimate) |
| refractive index | 1.7080 (estimate) |
| Flash point: | 310°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO, Methanol |
| pka | pK1: 5.46(+1) (20°C,μ=0.01) |
| form | Crystalline Powder or Granules |
| color | White to slightly yellow |
| Sensitive | Air Sensitive |
| BRN | 114479 |
| InChI | InChI=1S/C9H8N2/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1-6H,10H2 |
| InChIKey | XMIAFAKRAAMSGX-UHFFFAOYSA-N |
| SMILES | N1C2C(=C(N)C=CC=2)C=CC=1 |
| CAS DataBase Reference | 611-34-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Quinolinamine(611-34-7) |
Description and Uses
Intermediate in the preparation of P2X7 antagonists
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/38-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | VA9625000 |
| F | 2-10 |
| Hazard Note | Harmful/Irritant/Air Sensitive |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29334900 |
