A0742012
2-Amino-4-pyridinylmethanol , 97% , 105250-17-7
Synonym(s):
2-Amino-4-(hydroxymethyl)pyridine
CAS NO.:105250-17-7
Empirical Formula: C6H8N2O
Molecular Weight: 124.14
MDL number: MFCD03791261
EINECS: 641-277-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB65.60 | In Stock |
|
| 5G | RMB264.80 | In Stock |
|
| 25g | RMB1188.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 43-44°C |
| Boiling point: | 329.5±27.0 °C(Predicted) |
| Density | 1.257±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 13.37±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to yellow |
| Water Solubility | Soluble in water. |
| Sensitive | Air Sensitive |
| BRN | 8760550 |
| InChI | InChI=1S/C6H8N2O/c7-6-3-5(4-9)1-2-8-6/h1-3,9H,4H2,(H2,7,8) |
| InChIKey | ZRJJXXDQIQFZBW-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC(CO)=C1 |
| CAS DataBase Reference | 105250-17-7(CAS DataBase Reference) |
Description and Uses
2-Aminopyridine-4-methanol is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






