PRODUCT Properties
| Melting point: | 208 °C |
| Boiling point: | 443.4±34.0 °C(Predicted) |
| Density | 1.5425 (rough estimate) |
| refractive index | 1.4650 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in hot Toluene |
| form | powder to crystal |
| color | Light yellow to Brown to Dark green |
| InChI | InChI=1S/C14H7BrO2/c15-8-5-6-11-12(7-8)14(17)10-4-2-1-3-9(10)13(11)16/h1-7H |
| InChIKey | VTSDGYDTWADUJQ-UHFFFAOYSA-N |
| SMILES | C1=C2C(C(=O)C3=C(C2=O)C=CC=C3)=CC=C1Br |
| CAS DataBase Reference | 572-83-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P362+P364-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| RTECS | CB5950000 |
| HS Code | 29146990 |
