A0752812
3-Amino-4-methylpyridine , 98% , 3430-27-1
CAS NO.:3430-27-1
Empirical Formula: C6H8N2
Molecular Weight: 108.14
MDL number: MFCD00128871
EINECS: 608-968-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB92.80 | In Stock |
|
| 100G | RMB352.80 | In Stock |
|
| 500g | RMB1714.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102-107 °C |
| Boiling point: | 254°C |
| Density | 1.0275 (estimate) |
| refractive index | 1.5560 (estimate) |
| Flash point: | 254°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform, Ethyl Acetate, Methanol |
| form | powder to crystal |
| pka | 6.83±0.18(Predicted) |
| color | White to Brown |
| Sensitive | Hygroscopic |
| BRN | 107792 |
| InChI | InChI=1S/C6H8N2/c1-5-2-3-8-4-6(5)7/h2-4H,7H2,1H3 |
| InChIKey | IBKMZYWDWWIWEL-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(C)=C1N |
| CAS DataBase Reference | 3430-27-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Pyridinamine, 4-methyl-(3430-27-1) |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | T,Xn |
| Risk Statements | 23/24/25-36/37/38-41-37/38-22-20/21/22 |
| Safety Statements | 26-36/37/39-45-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |





![N-Methyl-N-((3S,4S)-4-methylpiperidin-3-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine](https://img.chemicalbook.com/CAS/GIF/1260614-73-0.gif)


