A0763912
3-Amino-3-azabicyclo[3.3.0]octane hydrochloride , 97% , 58108-05-7
CAS NO.:58108-05-7
Empirical Formula: C7H15ClN2
Molecular Weight: 162.66
MDL number: MFCD02093751
EINECS: 261-131-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB111.20 | In Stock |
|
| 100G | RMB348.00 | In Stock |
|
| 500g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-174 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly),Water (Slightly) |
| form | Solid |
| color | Off-White to Pale Beige |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C7H14N2.ClH/c8-9-4-6-2-1-3-7(6)5-9;/h6-7H,1-5,8H2;1H |
| InChIKey | WPYNXKFLSQEEFE-UHFFFAOYSA-N |
| SMILES | NN1CC2CCCC2C1.Cl |
| CAS DataBase Reference | 58108-05-7(CAS DataBase Reference) |
Description and Uses
3-Amino-3-azabicyclo[3,3,0]octane Hydrochloride is used as a reactant in the synthesis of cannabinoid receptor antagonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| REACH Registrations | Active |

![3-Amino-3-azabicyclo[3.3.0]octane hydrochloride](https://img.chemicalbook.com/CAS/GIF/58108-05-7.gif)



