A0779812
AZD5363 , ≥98% , 1143532-39-1
CAS NO.：1143532-39-1
Empirical Formula: C21H25ClN6O2
Molecular Weight: 428.92
MDL number: MFCD22628785
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB559.20 | In Stock |
|
| 5MG | RMB559.20 | In Stock |
|
| 50MG | RMB1542.40 | In Stock |
|
| 100MG | RMB2462.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 161-164°C |
| Density | 1.381 |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 13.93±0.50(Predicted) |
| form | Solid |
| color | Off-White to Pale Beige |
| InChIKey | JDUBGYFRJFOXQC-KRWDZBQOSA-N |
| SMILES | N1(C2N=CN=C3NC=CC3=2)CCC(N)(C(N[C@H](C2=CC=C(Cl)C=C2)CCO)=O)CC1 |
Description and Uses
AZD5363 is used in inhibiting the proliferation of certain tumor cell lines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
