A0794412
2-Amino-4,6-dichloro-5-formamidopyrimidine , ≥98.0%(HPLC) , 171887-03-9
CAS NO.：171887-03-9
Empirical Formula: C5H4Cl2N4O
Molecular Weight: 207.02
MDL number: MFCD04112936
EINECS: 425-650-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB68.00 | In Stock |
|
| 100g | RMB159.20 | In Stock |
|
| 500g | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >251°C (dec.) |
| Boiling point: | 554.8±60.0 °C(Predicted) |
| Density | 1.742±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | 10.90±0.70(Predicted) |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C5H4Cl2N4O/c6-3-2(9-1-12)4(7)11-5(8)10-3/h1H,(H,9,12)(H2,8,10,11) |
| InChIKey | XYWHZUCZNRMJGO-UHFFFAOYSA-N |
| SMILES | C(NC1=C(Cl)N=C(N)N=C1Cl)=O |
| CAS DataBase Reference | 171887-03-9(CAS DataBase Reference) |
Description and Uses
Abacavir intermediate. A purine derivative
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 2933.59.9500 |
