A0804612
Acenocoumarol , ≥98%(HPLC) , 152-72-7
Synonym(s):
(±)-Acenocoumarin;3-(α-Acetonyl-p-nitrobenzyl)-4-hydroxy-coumarin
CAS NO.：152-72-7
Empirical Formula: C19H15NO6
Molecular Weight: 353.33
MDL number: MFCD00137816
EINECS: 205-807-3
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB95.20 | In Stock |
|
| 25MG | RMB351.20 | In Stock |
|
| 100MG | RMB759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 196-1990C |
| Boiling point: | 486.76°C (rough estimate) |
| Density | 1.3979 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | DMSO, heptane and xylene: ≥17mg/mL |
| pka | pKa 4.7 (Uncertain) |
| form | powder |
| color | white to tan |
| InChI | 1S/C19H15NO6/c1-11(21)10-15(12-6-8-13(9-7-12)20(24)25)17-18(22)14-4-2-3-5-16(14)26-19(17)23/h2-9,15,22H,10H2,1H3 |
| InChIKey | VABCILAOYCMVPS-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(c1ccc(cc1)[N+]([O-])=O)C2=C(O)c3ccccc3OC2=O |
Description and Uses
Anticoagulant agent: Vitamin K antagonist
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 63-22-36/37/38 |
| Safety Statements | 26-36/37 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | GN4900000 |
| HS Code | 2932.20.2000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 152-72-7(Hazardous Substances Data) |
| Toxicity | LD50 orally in mice, rats: 1470, 1000 mg/kg (Leroux, Jamain) |
