A0817512
Aflatoxin B2 , ≥98%(HPLC) , 7220-81-7
Synonym(s):
Aflatoxin B2 solution
CAS NO.：7220-81-7
Empirical Formula: C17H14O6
Molecular Weight: 314.29
MDL number: MFCD00078140
EINECS: 230-618-8
| Pack Size | Price | Stock | Quantity |
| 1MG | RMB910.40 | In Stock |
|
| 5MG | RMB2292.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 286-289 °C |
| alpha | D -492° (c = 0.1 in CHCl3) |
| Boiling point: | 373.98°C (rough estimate) |
| Density | 1.2564 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| Flash point: | 11 °C |
| storage temp. | 2-8°C |
| solubility | DMF: 20 mg/ml; DMF:PBS(pH 7.2)(1:1): 0.5 mg/ml; DMSO: 12 mg/ml |
| form | Solid |
| color | White to off-white |
| Water Solubility | 15mg/L(temperature not stated) |
| Merck | 13,180 |
| BRN | 1355115 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C17H14O6/c1-20-10-6-11-14(8-4-5-21-17(8)22-11)15-13(10)7-2-3-9(18)12(7)16(19)23-15/h6,8,17H,2-5H2,1H3/t8-,17+/m0/s1 |
| InChIKey | WWSYXEZEXMQWHT-WNWIJWBNSA-N |
| SMILES | [H][C@@]12CCO[C@]1([H])Oc3cc(OC)c4C5=C(C(=O)CC5)C(=O)Oc4c23 |
| LogP | 1.802 (est) |
| CAS DataBase Reference | 7220-81-7 |
Description and Uses
Aflatoxin B2 is the minor analogue of the blue fluorescent family of bisfuranocoumarin mycotoxins produced by Aspergillus flavus and related species. Alfatoxins are one of the most potent mycotoxins known but are in fact "pre-toxins", requiring metabolic activation to the toxic principle. Aflatoxins are found widely in nature in trace amounts, particularly in grains and nuts. The toxicity of these metabolites was first recognised in the 1950s and their structures elucidated in 1963. Aflatoxins have been extensively reviewed.
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H340-H350 |
| Precautionary statements | P201-P262-P280-P301+P310+P330-P302+P352+P310-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T+,T,F,Xn |
| Risk Statements | 45-26/27/28-39/23/24/25-23/24/25-11-65-48/23/24/25-36/38-46-36-20/21/22 |
| Safety Statements | 53-36-45-36/37-26-62-28-16 |
| RIDADR | UN 3462 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | GY1722000 |
| F | 10 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 29322090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
| Hazardous Substances Data | 7220-81-7(Hazardous Substances Data) |
| Toxicity | LD50 orally in day old duckling: 84.8 mg/50 gm body wt (Carnaghan) |
