A0818312
4-(4-Aminophenyl)morpholin-3-one , ≥98% , 438056-69-0
CAS NO.:438056-69-0
Empirical Formula: C10H12N2O2
Molecular Weight: 192.21
MDL number: MFCD08236742
EINECS: 610-147-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB28.00 | In Stock |
|
| 25G | RMB63.20 | In Stock |
|
| 100g | RMB231.20 | In Stock |
|
| 500g | RMB1023.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171.0 to 175.0 °C |
| Boiling point: | 502.3±45.0 °C(Predicted) |
| Density | 1.268 |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 4.85±0.10(Predicted) |
| color | White to Light Brown |
| Water Solubility | 16.6g/L at 20℃ |
| InChI | InChI=1S/C10H12N2O2/c11-8-1-3-9(4-2-8)12-5-6-14-7-10(12)13/h1-4H,5-7,11H2 |
| InChIKey | MHCRLDZZHOVFEE-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=C(N)C=C2)CCOCC1=O |
| LogP | -0.8 at 25℃ |
| CAS DataBase Reference | 438056-69-0 |
Description and Uses
4-(4-AMINOPHENYL)MORPHOLIN-3-ONE is used in the preparation of various Morpholine based pharmaceuticals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Safety Statements | 24/25 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |







