BD9266031
(R)-2-(2-Hydroxy-3-((4-(3-oxomorpholino)phenyl)amino)propyl)isoindoline-1,3-dione , 97% , 446292-07-5
CAS NO.：446292-07-5
Empirical Formula: C21H21N3O5
Molecular Weight: 395.41
MDL number: MFCD11977664
EINECS: 610-200-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB32.80 | In Stock |
|
| 250mg | RMB55.20 | In Stock |
|
| 1g | RMB148.80 | In Stock |
|
| 5g | RMB520.00 | In Stock |
|
| 25g | RMB1820.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208-211°C |
| Boiling point: | 734.9±60.0 °C(Predicted) |
| Density | 1.421 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 13.91±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 37mg/L at 20℃ |
| InChI | InChI=1S/C21H21N3O5/c25-16(12-24-20(27)17-3-1-2-4-18(17)21(24)28)11-22-14-5-7-15(8-6-14)23-9-10-29-13-19(23)26/h1-8,16,22,25H,9-13H2/t16-/m1/s1 |
| InChIKey | CKFVSMPWXAASIQ-MRXNPFEDSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1C[C@H](O)CNC1=CC=C(N2CCOCC2=O)C=C1 |
| LogP | 0.6 at 25℃ |
| CAS DataBase Reference | 446292-07-5 |
Description and Uses
Rivaroxaban intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P261-P271-P304+P340-P312-P280-P302+P352-P312-P322-P363-P501 |
| HS Code | 2922498590 |
