BD8860831
                    (S)-4-(4-(5-(Aminomethyl)-2-oxooxazolidin-3-yl)phenyl)morpholin-3-one , 97% , 446292-10-0
CAS NO.:446292-10-0
Empirical Formula: C14H17N3O4
Molecular Weight: 291.3
MDL number: MFCD11977666
EINECS: 692-970-2
| Pack Size | Price | Stock | Quantity | 
| 100mg | RMB68.00 | In Stock | 
                                                 | 
                                        
| 250mg | RMB113.60 | In Stock | 
                                                 | 
                                        
| 1g | RMB288.80 | In Stock | 
                                                 | 
                                        
| 5g | RMB876.00 | In Stock | 
                                                 | 
                                        
| 25g | RMB2628.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 148.3-149.8 °C | 
                                    
| Boiling point: | 580.4±45.0 °C(Predicted) | 
                                    
| Density | 1.348±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | 
                                    
| pka | 8.96±0.29(Predicted) | 
                                    
| InChI | InChI=1S/C14H17N3O4/c15-7-12-8-17(14(19)21-12)11-3-1-10(2-4-11)16-5-6-20-9-13(16)18/h1-4,12H,5-9,15H2/t12-/m0/s1 | 
                                    
| InChIKey | DEXXSYVEWAYIGZ-LBPRGKRZSA-N | 
                                    
| SMILES | N1(C2=CC=C(N3C[C@H](CN)OC3=O)C=C2)CCOCC1=O | 
                                    
Description and Uses
A metabolite of Rivaroxaban (R538000).
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H319-H335-H315 | 
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 | 







