A0831112
Acetaldehyde 2,4-Dinitrophenylhydrazone , >98.0%(HPLC) , 1019-57-4
Synonym(s):
Acetaldehyde-2,4-dinitrophenylhydrazone;Acetaldehyde-2,4-dinitrophenylhydrazone solution
CAS NO.：1019-57-4
Empirical Formula: C8H8N4O4
Molecular Weight: 224.17
MDL number: MFCD00191298
EINECS: 627-217-9
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB88.00 | In Stock |
|
| 1G | RMB319.20 | In Stock |
|
| 5g | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164°C |
| Boiling point: | 382.5±42.0 °C(Predicted) |
| Density | 1.47±0.1 g/cm3(Predicted) |
| Flash point: | 7 °C |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | powder or crystals |
| pka | 12.29±0.10(Predicted) |
| Stability: | Hygroscopic |
| Major Application | diagnostic assay manufacturing environmental hematology histology |
| InChI | 1S/C8H8N4O4/c1-2-9-10-7-4-3-6(11(13)14)5-8(7)12(15)16/h2-5,10H,1H3/b9-2+ |
| InChIKey | ONBOQRNOMHHDFB-XNWCZRBMSA-N |
| SMILES | C\C=N\Nc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O |
| CAS DataBase Reference | 1019-57-4(CAS DataBase Reference) |
Description and Uses
Acetaldehyde 2,4-Dinitrophenylhydrazone is a dinitrophenylhydrazone (DNPH) derivative of an aliphatic alldehyde found in mainstream cigarette smoke.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | F,Xn |
| Risk Statements | 22-36/37/38-36-20/21/22-11-43 |
| Safety Statements | 26-36-36/37-16 |
| RIDADR | UN 1648 3/PG 2 |
| WGK Germany | 3 |
| RTECS | AB2826500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
