A0841812
2-Amino-6-(trifluoromethyl)benzothiazole , >98.0%(HPLC) , 777-12-8
Synonym(s):
6-(Trifluoromethyl)-1,3-benzothiazol-2-ylamine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB140.00 | In Stock |
|
| 5G | RMB404.00 | In Stock |
|
| 25G | RMB1293.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-124 °C |
| Boiling point: | 306.7±52.0 °C(Predicted) |
| Density | 1.536±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.52±0.10(Predicted) |
| color | Light orange to Yellow to Green |
| Sensitive | Stench |
| InChI | InChI=1S/C8H5F3N2S/c9-8(10,11)4-1-2-5-6(3-4)14-7(12)13-5/h1-3H,(H2,12,13) |
| InChIKey | WEDYEBJLWMPPOK-UHFFFAOYSA-N |
| SMILES | S1C2=CC(C(F)(F)F)=CC=C2N=C1N |
| CAS DataBase Reference | 777-12-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-25 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29342000 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




![6-(Trifluoromethyl)benzo[d]thiazole](https://img.chemicalbook.com/CAS/GIF/131106-70-2.gif)

![5-(Trifluoromethyl)benzo[d]thiazol-2-amine](https://img.chemicalbook.com/CAS/GIF/60388-38-7.gif)