PRODUCT Properties
| Melting point: | 188-190 °C(lit.) |
| Boiling point: | 311.8°C (rough estimate) |
| Density | 1.0020 (rough estimate) |
| refractive index | 1.5065 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Dichloromethane, Methanol |
| form | Solid |
| pka | 16.85±0.20(Predicted) |
| color | White |
| BRN | 2047887 |
| InChI | 1S/C11H17NO/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H2,12,13)/t7-,8+,9-,11- |
| InChIKey | CKBZJTAMRPPVSR-KJZNFTALSA-N |
| SMILES | NC(=O)C12C[C@H]3C[C@H](C[C@H](C3)C1)C2 |
| CAS DataBase Reference | 5511-18-2(CAS DataBase Reference) |
Description and Uses
Reproduction of Sindbis virus strains sensitive and resistant to 1-adamantanecarboxamide
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | AU4452000 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
