2-(4-dimethylaminostyryl)-1-methyl-pyridiniumiodide , 98% , 2156-29-8
Synonym(s):
2-Di-1-ASP
CAS NO.:2156-29-8
Empirical Formula: C16H19IN2
Molecular Weight: 366.24
MDL number: MFCD00011980
EINECS: 218-460-8
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB119.20 | In Stock |
|
| 250mg | RMB231.20 | In Stock |
|
| 1g | RMB562.40 | In Stock |
|
| 5g | RMB2112.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 280 °C (dec.)(lit.) |
| solubility | DMSO: soluble |
| form | Solid |
| color | Pink to red |
| λmax | 466 nm |
| BRN | 3776369 |
| InChI | 1S/C16H19N2.HI/c1-17(2)15-10-7-14(8-11-15)9-12-16-6-4-5-13-18(16)3;/h4-13H,1-3H3;1H/q+1;/p-1 |
| InChIKey | XPOIQAIBZGSIDD-UHFFFAOYSA-M |
| SMILES | [I-].CN(C)c1ccc(cc1)\C=C\c2cccc[n+]2C |
Description and Uses
2-[4-(Dimethylamino)styryl]-1-methylpyridinium iodide, a synthetic compound with intricate chemical structure, finds application in the realm of scientific research. Noteworthy for its fluorescent properties, it functions as a vital tool in the visualization and identification of diverse biological entities such as proteins, DNA, and membranes. In the sphere of biomedical investigations, particularly in fluorescence microscopy and flow cytometry studies, this compound plays a pivotal role in enhancing the understanding of cellular processes.
DASPMI is a polar sensitive dye that measures the membrane potential of mitochondria in living cells. It may be used as a light absorber in the development of a photoinitiator based system.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8-10 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





