A0853312
4-Aminononafluorobiphenyl , >96.0%(GC) , 969-25-5
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB143.20 | In Stock |
|
| 1G | RMB503.20 | In Stock |
|
| 5G | RMB1759.20 | In Stock |
|
| 25g | RMB6159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146 °C |
| Boiling point: | 242.9±35.0 °C(Predicted) |
| Density | 1.699±0.06 g/cm3(Predicted) |
| solubility | soluble in Toluene |
| form | powder to crystal |
| pka | -0.69±0.21(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C12H2F9N/c13-3-1(4(14)8(18)9(19)7(3)17)2-5(15)10(20)12(22)11(21)6(2)16/h22H2 |
| InChIKey | DVKUPHGYOMHVDR-UHFFFAOYSA-N |
| SMILES | C1(C2=C(F)C(F)=C(F)C(F)=C2F)=C(F)C(F)=C(N)C(F)=C1F |
| CAS DataBase Reference | 969-25-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2922290090 |
![4'-Fluoro-[1,1'-biphenyl]-4-amine](https://img.chemicalbook.com/CAS/GIF/324-93-6.gif)
