A0855112
4-Acetyl-4'-bromobiphenyl , >98.0%(GC) , 5731-01-1
CAS NO.:5731-01-1
Empirical Formula: C14H11BrO
Molecular Weight: 275.14
MDL number: MFCD00143242
EINECS: 227-236-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB120.00 | In Stock |
|
| 25G | RMB479.20 | In Stock |
|
| 100G | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-133 °C(lit.) |
| Boiling point: | 372.1±17.0 °C(Predicted) |
| Density | 1.359±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 2048590 |
| InChI | InChI=1S/C14H11BrO/c1-10(16)11-2-4-12(5-3-11)13-6-8-14(15)9-7-13/h2-9H,1H3 |
| InChIKey | UUVKNCRMWPNBNM-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(C2=CC=C(Br)C=C2)C=C1)C |
| CAS DataBase Reference | 5731-01-1(CAS DataBase Reference) |
Description and Uses
4-Acetyl-4'-bromobiphenyl is mainly used as a reagent for experimental organic synthesis or reactions, including substitution reactions or the synthesis and polymerisation of biphenyl derivatives.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H319-H411 |
| Precautionary statements | P273-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,N |
| Risk Statements | 36-51/53 |
| Safety Statements | 26-36-61-24/25-22 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HS Code | 2914790090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 |





![2-Bromo-1-(4'-bromo-[1,1'-biphenyl]-4-yl)ethanone](https://img.chemicalbook.com/CAS/GIF/94512-73-9.gif)

