A0866712
4-Amino-4'-(<i>N</i>,<i>N</i>-dimethylamino)stilbene , 98% , 22525-43-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB263.20 | In Stock |
|
| 1G | RMB743.20 | In Stock |
|
| 5G | RMB2656.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 172°C |
| Boiling point: | 429.5±34.0 °C(Predicted) |
| Density | 1.119±0.06 g/cm3(Predicted) |
| pka | 4.57±0.12(Predicted) |
| form | powder to crystal |
| color | Light yellow to Brown |
| InChI | 1S/C16H18N2/c1-18(2)16-11-7-14(8-12-16)4-3-13-5-9-15(17)10-6-13/h3-12H,17H2,1-2H3/b4-3+ |
| InChIKey | GCHSJPKVJSMRDX-ONEGZZNKSA-N |
| SMILES | CN(C)c1ccc(\C=C\c2ccc(N)cc2)cc1 |
| EPA Substance Registry System | Benzenamine, 4-[2-(4-aminophenyl)ethenyl]-N,N-dimethyl- (22525-43-5) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HS Code | 2921.59.8090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
