PRODUCT Properties
| Melting point: | <-18.15°C |
| Boiling point: | 101-102 °C15 mm Hg(lit.) |
| Density | 1.183 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 201 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| pka | -2.03±0.30(Predicted) |
| color | Clear yellow to brown-red |
| InChI | InChI=1S/C7H5NO/c1-2-4-7-6(3-1)5-9-8-7/h1-5H |
| InChIKey | FZKCAHQKNJXICB-UHFFFAOYSA-N |
| SMILES | N1=C2C(C=CC=C2)=CO1 |
| CAS DataBase Reference | 271-58-9(CAS DataBase Reference) |
Description and Uses
Anthranil undergoes thermal decomposition during single pulse shock-tube experiments to form aniline and cyclopentadiene carbonitrile. Surface-enhanced Raman spectrum of anthranil in activated silver colloid has been studied.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 24/25-25-24 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral |




![5-Chloro-3-phenylbenzo[c]isoxazole](https://img.chemicalbook.com/CAS/GIF/719-64-2.gif)
![(3-Methylbenzo[d]isoxazol-5-yl)methanamine](https://img.chemicalbook.com/CAS/20150408/GIF/267875-58-1.gif)
