BD0674245
5-Chloro-3-phenylbenzo[c]isoxazole , 95% , 719-64-2
CAS NO.:719-64-2
Empirical Formula: C13H8ClNO
Molecular Weight: 229.66
MDL number: MFCD00014573
EINECS: 211-950-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB24.00 | In Stock |
|
| 250mg | RMB28.80 | In Stock |
|
| 1g | RMB35.20 | In Stock |
|
| 5g | RMB87.20 | In Stock |
|
| 25g | RMB296.00 | In Stock |
|
| 100g | RMB1148.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-117 °C(lit.) |
| Boiling point: | 395.4±22.0 °C(Predicted) |
| Density | 1.298 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -4.98±0.30(Predicted) |
| form | Crystalline Powder |
| color | Yellow |
| InChI | InChI=1S/C13H8ClNO/c14-10-6-7-12-11(8-10)13(16-15-12)9-4-2-1-3-5-9/h1-8H |
| InChIKey | MUHJZJKVEQASGY-UHFFFAOYSA-N |
| SMILES | N1=C2C(C=C(Cl)C=C2)=C(C2=CC=CC=C2)O1 |
| CAS DataBase Reference | 719-64-2(CAS DataBase Reference) |
| EPA Substance Registry System | 2,1-Benzisoxazole, 5-chloro-3-phenyl- (719-64-2) |
Description and Uses
5-Chloro-3-phenyl-2,1-benzisoxazole, is a Heterocyclic Building Block used for the synthesis of pharmaceuticals and other organic compounds. It is used in the synthesis of novel 2H-1, 4-benzodiazepine-2-ones as inhibitors of HIV-1 transcription.It can also be sued for the synthesis of Nitroacridinones derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H413-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-36 |
| Safety Statements | 26-36/37/39-37 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 2934.99.4400 |

![5-Chloro-3-phenylbenzo[c]isoxazole](https://img.chemicalbook.com/CAS/GIF/719-64-2.gif)





