A2261412
2-Chlorobenzophenone , 99% , 5162-03-8
Synonym(s):
2-Chlorobenzophenone(Clotrimazole Impurity E)
CAS NO.:5162-03-8
Empirical Formula: C13H9ClO
Molecular Weight: 216.66
MDL number: MFCD00000558
EINECS: 225-936-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB25.60 | In Stock |
|
| 25G | RMB44.00 | In Stock |
|
| 100G | RMB128.80 | In Stock |
|
| 250g | RMB159.20 | In Stock |
|
| 500g | RMB316.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44-47 °C(lit.) |
| Boiling point: | 330 °C(lit.) |
| Density | 1,18g/cm |
| refractive index | 1.5260 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| BRN | 1869594 |
| InChI | InChI=1S/C13H9ClO/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10/h1-9H |
| InChIKey | VMHYWKBKHMYRNF-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1Cl)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 5162-03-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Methanone, (2-chlorophenyl)phenyl-(5162-03-8) |
| EPA Substance Registry System | Methanone, (2-chlorophenyl)phenyl- (5162-03-8) |
Description and Uses
(2-Chlorophenyl)phenyl-methanone is a metabolite of Clofedanol (C586920). Chlorobenzophenone is also used as a catalyst in the photocrosslinking of polyethylenes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 37/39-26-24/25-36 |
| WGK Germany | 3 |
| RTECS | PC4945633 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29143990 |
| Storage Class | 11 - Combustible Solids |







