BD9007931
(2-Chlorophenyl)(4-chlorophenyl)methanone , 98% , 85-29-0
CAS NO.:85-29-0
Empirical Formula: C13H8Cl2O
Molecular Weight: 251.11
MDL number: MFCD00038744
EINECS: 201-596-7
| Pack Size | Price | Stock | Quantity |
| 10g | RMB38.40 | In Stock |
|
| 25g | RMB75.20 | In Stock |
|
| 100g | RMB244.80 | In Stock |
|
| 500g | RMB963.20 | In Stock |
|
| 1000g | RMB1269.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64°C |
| Boiling point: | 214 °C / 22mmHg |
| Density | 1.3930 |
| refractive index | 1.5555 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| BRN | 1959090 |
| InChI | InChI=1S/C13H8Cl2O/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15/h1-8H |
| InChIKey | YXMYPHLWXBXNFF-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1Cl)(C1=CC=C(Cl)C=C1)=O |
| CAS DataBase Reference | 85-29-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,4'-Dichlorobenzophenone(85-29-0) |
| EPA Substance Registry System | Methanone, (2-chlorophenyl)(4-chlorophenyl)- (85-29-0) |
Description and Uses
2,4''-Dichlorobenzophenone is used in the synthesis of triarylcarbinol analogs of fenarimol as potent inhibitors of Trypanosoma cruzi. It can also be used to prepare fatty acid amide hydrolase inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38-38-37-36 |
| Safety Statements | 26-36/37/39-37 |
| TSCA | TSCA listed |
| HS Code | 29143990 |







