A0896112
4'-Acetamido-3'-bromoacetophenone , >98.0% , 101209-08-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB103.20 | In Stock |
|
| 5G | RMB311.20 | In Stock |
|
| 25g | RMB1255.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139-141°C |
| Boiling point: | 436.1±40.0 °C(Predicted) |
| Density | 1.504±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | 13.66±0.70(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 3272108 |
| InChI | 1S/C10H10BrNO2/c1-6(13)8-3-4-10(9(11)5-8)12-7(2)14/h3-5H,1-2H3,(H,12,14) |
| InChIKey | PMYJAVHDFDKJBS-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(cc1Br)C(C)=O |
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 22-24/25-45 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| HS Code | 2924.29.7790 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
