A0930550
2,2,2-Trichloro-1,1-dimethylethylchloroformate , 98% , 66270-36-8
Synonym(s):
β,β,β-Trichloro-tert-butoxycarbonyl chloride;β,β,β-Trichloro-tert-butyl chloroformate;TCBoc-chloride
CAS NO.:66270-36-8
Empirical Formula: C5H6Cl4O2
Molecular Weight: 239.91
MDL number: MFCD00000801
EINECS: 266-293-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB135.20 | In Stock |
|
| 5g | RMB388.00 | In Stock |
|
| 25g | RMB1444.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 28-30 °C(lit.) |
| Boiling point: | 83-84 °C14 mm Hg(lit.) |
| Density | 1.4953 (estimate) |
| storage temp. | 2-8°C |
| solubility | ethanol: soluble10%, clear, colorless |
| form | solid |
| BRN | 1935464 |
| InChI | InChI=1S/C5H6Cl4O2/c1-4(2,5(7,8)9)11-3(6)10/h1-2H3 |
| InChIKey | GMELMFSDPDSXOZ-UHFFFAOYSA-N |
| SMILES | C(Cl)(OC(C)(C)C(Cl)(Cl)Cl)=O |
Description and Uses
Used as easily removable acid- and base-stable protecting group for nitrogen, including amino acids and nucleosides; protecting group for alcohols.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H314 |
| Precautionary statements | P260-P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 23/24/25-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2928 6.1/PG 2 |
| WGK Germany | 3 |
| F | 4.5-10-19-21 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Skin Corr. 1B |






