A0959212
1-Adamantanethiol , 95% , 34301-54-7
Synonym(s):
1-AD;1-AdmSH;1-AdSH;ADT
| Pack Size | Price | Stock | Quantity |
| 1g | RMB111.20 | In Stock |
|
| 5G | RMB399.20 | In Stock |
|
| 25g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 99-106 °C |
| Boiling point: | 237.8±9.0℃ (760 Torr) |
| Density | 1.09±0.1 g/cm3 (20 ºC 760 Torr) |
| Flash point: | 94.2±16.7℃ |
| storage temp. | Storage temp. 2-8°C |
| form | solid |
| pka | 11.05±0.20(Predicted) |
| Appearance | White to off-white Solid |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C10H16S/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9,11H,1-6H2 |
| InChIKey | ADJJLNODXLXTIH-UHFFFAOYSA-N |
| SMILES | C12(S)CC3CC(CC(C3)C1)C2 |
Description and Uses
AT can be used to functionalize folic acid based polyethylene glycol-maleimide which can be used in the development of gold nanorod (AuNR) based mixtures for spatiotemporal delivery of anticancer therapeutics. It can also be used with 1-octadecanethiol which forms SAM on palladium/aluminum oxide (Pd/Al2O3) which finds potential application as a controlled catalyst.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319 |
| Precautionary statements | P301+P310+P330-P305+P351+P338 |
| Hazard Codes | T,N |
| Risk Statements | 25-36-51/53 |
| Safety Statements | 26-36/37-45-60-61 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 2930909899 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
