PRODUCT Properties
| Melting point: | 189-198 °C |
| Boiling point: | 239℃ |
| Density | 1.166 |
| Flash point: | 82℃ |
| storage temp. | -20°C, protect from light, stored under nitrogen |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C11H16O/c12-7-11-4-8-1-9(5-11)3-10(2-8)6-11/h7-10H,1-6H2 |
| InChIKey | DZULQZKFBAHSRX-UHFFFAOYSA-N |
| SMILES | C12(C=O)CC3CC(CC(C3)C1)C2 |
Description and Uses
1-Adamantylcarboxaldehyde is an intermediate used to prepare 2-adamantyl-substituted thiazolidin-4-ones with anti-HIV activities. It is also used to synthesize Saxagliptin (S143500).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P261-P280-P305+P351+P338-P304+P340-P405 |
| HS Code | 2902190000 |
