Adenine 9-β-<SC>D</SC>-arabinofuranoside , 99% , 5536-17-4
Synonym(s):
9-β-D -Arabinofuranosyladenine;Ara-A;Vidarabine
CAS NO.:5536-17-4
Empirical Formula: C10H13N5O4
Molecular Weight: 267.25
MDL number: MFCD00005752
EINECS: 226-893-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB126.40 | In Stock |
|
| 25G | RMB408.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 260-265 °C (dec.) |
| alpha | D27 -5° (c = 0.25) |
| Boiling point: | 410.43°C (rough estimate) |
| Density | 1.3382 (rough estimate) |
| refractive index | 1.7610 (estimate) |
| storage temp. | -20°C |
| solubility | DMSO (Slightly, Heated) |
| form | Powder |
| pka | pKa 3.55(H2O
t=20
I=0.1 (KCl)) (Uncertain);11.4 (Uncertain) |
| color | White to Off-white |
| Water Solubility | Soluble in DMF (10 mg/ml), 0.5 M HCl (50 mg/ml), DMSO (53 mg/ml at 25°C), ethanol (<1 mg/ml at 25°C), and water (3 mg/ml at 25°C). |
| Merck | 13,10039 |
| BRN | 624881 |
| InChI | 1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7+,10-/m1/s1 |
| InChIKey | OIRDTQYFTABQOQ-UHTZMRCNSA-N |
| SMILES | Nc1ncnc2n(cnc12)[C@@H]3O[C@H](CO)[C@@H](O)[C@@H]3O |
| LogP | -0.755 (est) |
| CAS DataBase Reference | 5536-17-4(CAS DataBase Reference) |
| EPA Substance Registry System | Vidarabine (5536-17-4) |
Description and Uses
Vidarabine (adenine arabinoside) is the stereoisomer of adenosine. This analog of a purine nucleoside exhibits selective activity against the herpes virus. The ribose residue is replaced with an arabinose residue. Like acyclovir, it turns into mono-, di-, and triphosphate in cells infected by a virus, thus inhibiting DNA polymerase, and correspondingly preventing DNA synthesis of the virus approximately 20–40 times more than in “host” cells. It is easily metabolized to a less active, yet nonetheless antiviral compound—arabinosylhypoxanthine. It has been successfully used for herpetic encephalitis, and for complicated shingles. It is used in the form of eye drops for herpetic keratoconjuctivitis. A synonym of this drug is Vira-A.
antifungal;Antiviral;Adenosine antimetabolite.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H361d |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 63-36/37/38 |
| Safety Statements | 36/37-36-26 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | AU6200000 |
| F | 10-23 |
| TSCA | TSCA listed |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Repr. 2 |
| Hazardous Substances Data | 5536-17-4(Hazardous Substances Data) |
| Toxicity | LD50 in mice (mg/kg): 4677 i.p.; >7950 orally (Kurtz) |





