A0971850
Quininedihydrochloridemonohydrate , ≥98% , 60-93-5
CAS NO.:60-93-5
Empirical Formula: C20H26Cl2N2O2
Molecular Weight: 397.34
MDL number: MFCD00151247
EINECS: 200-493-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB215.20 | In Stock |
|
| 5g | RMB640.80 | In Stock |
|
| 25g | RMB2361.60 | In Stock |
|
| 100g | RMB7199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 238-2400C |
| Stability: | Stable, but may be light sensitive. Efflorescent. Incompatible with strong oxidizing agents. |
| InChIKey | LBSFSRMTJJPTCW-QJLYHTAINA-N |
| SMILES | [C@H]([C@]1([H])C[C@@H]2CC[N@]1C[C@@H]2C=C)(C1=CC=NC2=CC=C(OC)C=C12)O.Cl |&1:0,1,4,7,9,r| |
| LogP | 3.440 (est) |
| CAS DataBase Reference | 60-93-5(CAS DataBase Reference) |
| EPA Substance Registry System | Cinchonan-9-ol, 6'-methoxy-, dihydrochloride, (8.alpha.,9R)- (60-93-5) |
Description and Uses
Primary alkaloid of various species of Cinchona (Rubiaceae). Optical isomer of Quinidine. Antimalarial; muscle relaxant (skeletal)
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312-P304+P340+P312-P305+P351+P338-P332+P313-P337+P313-P362-P363-P403+P233-P405-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 1544 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29392000 |






![4-[2-(Methylamino)ethyl]pyridinedihydrochloride](https://img.chemicalbook.com/CAS/GIF/101252-40-8.gif)