T9845330
Quinuclidine Hydrochloride , >98.0%(T) , 39896-06-5
Synonym(s):
1-Azabicyclo[2.2.2]octane hydrochloride
CAS NO.:39896-06-5
Empirical Formula: C7H14ClN
Molecular Weight: 147.65
MDL number: MFCD00012727
EINECS: 254-682-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB784.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| solubility | H2O: 0.1 g/mL, clear |
| form | powder to crystal |
| color | White to Almost white |
| Merck | 14,8081 |
| BRN | 3675063 |
| InChI | InChI=1S/C7H13N.ClH/c1-4-8-5-2-7(1)3-6-8;/h7H,1-6H2;1H |
| InChIKey | BZLBBZLOMXKMTA-UHFFFAOYSA-N |
| SMILES | C12CCN(CC1)CC2.Cl |
Description and Uses
Quinuclidine hydrochloride was used in the synthesis of quinuclidine adducts with group 13 trihydride molecules, MH3 (M = B, Al) and their structure elucidation by gas-phase electron diffraction and quantum chemical calculations. It was used to investigate series of organic hydrochloride salts by solid-state 35Cl and 37Cl NMR spectroscopy.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 2933.39.6190 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |







